Nonsubstrate Confidence: Moderate
Formula: C27H32N2O11S1
SMILES: N#CC3C(N(C1OC(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1(OC(=O)C))C(C)C(C(=O)C)C3(c2occc2))=S
Rule-of-Five (Proudfoot 2005)
Hydrogen bond donors: 0Violations:
Hydrogen bond acceptors: 13
Molecular weight: 592,17
Octanol-water partition coefficient (XlogP): 1,09
Toxicity risk factors:
Total polar surface area: 203.76Toxic or clean:
Octanol-water partition coefficient (XlogP): 1.09

SVM prediction


Current compound
(p = 0,65)


(p = 0,82)


(p = 0,92)


(p = 0,93)


(p = 0,99)


Cyclosporin A
(p = 0,79)

Cyclosporin A

(p = 0,78)


(p = 0,85)


(p = 0,98)



Fragments that are more likely to appear in P-gp substrates
None present


95% CI=[0, +∞]

SMARTS: [!#1]c1c([!#1])c([!#1])c([!#1])c([!#1])c1[!#1]

Enrichment: 5.67
95% CI=[1.69, 19.02]

SMARTS: [!#1][CH2][CH2][CH2][NH][!#1]

Enrichment: 3.71
95% CI=[1.65, 8.35]

SMARTS: [!#1][NH2]

Enrichment: 3.21
95% CI=[1.83, 5.65]

SMARTS: [!#1][CH2][CH2][NH][!#1]

Enrichment: 3.14
95% CI=[1.78, 5.54]

SMARTS: c1ccc2ncccc2c1

Enrichment: 2.91
95% CI=[1.51, 5.60]

SMARTS: [!#1][CH2][NH][!#1]

Enrichment: 2.88
95% CI=[1.73, 4.82]
Fragments that are more likely to appear in P-gp nonsubstrates
10 present

SMARTS: [!#1][CH]([!#1])[CH2][CH2]C([!#1])([!#1])[CH3]

Enrichment: 14
95% CI=[1.86, 105.4]


Enrichment: 7.5
95% CI=[1.74, 32.34]


Enrichment: 6.5
95% CI=[2.31, 18.26]


Enrichment: 3.22
95% CI=[1.57, 6.62]


Enrichment: 3.09
95% CI=[1.62, 5.92]


Enrichment: 2.29
95% CI=[1.48, 3.54]


Enrichment: 2.21
95% CI=[1.50, 3.26]


Enrichment: 2.19
95% CI=[1.36, 3.52]


Enrichment: 2.18
95% CI=[1.52, 3.12]


Enrichment: 2.17
95% CI=[1.39, 3.41]


Enrichment: 2.13
95% CI=[1.47, 3.07]


Enrichment: 2.04
95% CI=[1.36, 3.05]


Enrichment: 2.04
95% CI=[1.36, 3.05]


Enrichment: 2.03
95% CI=[1.38, 3.00]


Enrichment: 2.03
95% CI=[1.40, 2.95]


Enrichment: 2.03
95% CI=[1.44, 2.86]


Enrichment: 2.00
95% CI=[1.38, 2.90]

Decision tree